C21H22 — CID 139667552
(2,4-diethyl-5-phenylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 139667552) has the molecular formula C21H22 and a molecular weight of 274.41 g/mol. Its IUPAC name is (2,4-diethyl-5-phenylcyclopenta-1,4-dien-1-yl)benzene.
| Compound Name | (2,4-diethyl-5-phenylcyclopenta-1,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 139667552 |
| Molecular Formula | C21H22 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (2,4-diethyl-5-phenylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | CCC1=C(c2ccccc2)C(c2ccccc2)=C(CC)C1 |
| InChI | InChI=1S/C21H22/c1-3-16-15-17(4-2)21(19-13-9-6-10-14-19)20(16)18-11-7-5-8-12-18/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | ADFANEVNVMFXCQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |