C20H34O2 — CID 91033003
1,1'-biphenyl;methanol;propane (PubChem CID 91033003) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1,1'-biphenyl;methanol;propane.
| Compound Name | 1,1'-biphenyl;methanol;propane |
|---|---|
| PubChem CID | 91033003 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1,1'-biphenyl;methanol;propane |
| SMILES | CCC.CCC.CO.CO.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.2C3H8.2CH4O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-3-2;2*1-2/h1-10H;2*3H2,1-2H3;2*2H,1H3 |
| InChIKey | WILFROTZYYAKFX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |