C15H17NO — CID 155213147
1,1'-biphenyl;propanamide (PubChem CID 155213147) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 1,1'-biphenyl;propanamide.
| Compound Name | 1,1'-biphenyl;propanamide |
|---|---|
| PubChem CID | 155213147 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1,1'-biphenyl;propanamide |
| SMILES | CCC(N)=O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3H7NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3(4)5/h1-10H;2H2,1H3,(H2,4,5) |
| InChIKey | GPXFBKWEAXPHJL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |