C14H15NO2 — CID 174302760
1,1'-biphenyl;2-hydroxyacetamide (PubChem CID 174302760) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1,1'-biphenyl;2-hydroxyacetamide.
| Compound Name | 1,1'-biphenyl;2-hydroxyacetamide |
|---|---|
| PubChem CID | 174302760 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1,1'-biphenyl;2-hydroxyacetamide |
| SMILES | NC(=O)CO.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H5NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-2(5)1-4/h1-10H;4H,1H2,(H2,3,5) |
| InChIKey | JDGOUXWVCJUOMH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |