About 2-(3,4,5-triphenylphenyl)acetamide
2-(3,4,5-triphenylphenyl)acetamide (PubChem CID 178028831) has the molecular formula C26H21NO
and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-(3,4,5-triphenylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(3,4,5-triphenylphenyl)acetamide |
| PubChem CID | 178028831 |
| Molecular Formula | C26H21NO |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-(3,4,5-triphenylphenyl)acetamide |
| SMILES | NC(=O)Cc1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H21NO/c27-25(28)18-19-16-23(20-10-4-1-5-11-20)26(22-14-8-3-9-15-22)24(17-19)21-12-6-2-7-13-21/h1-17H,18H2,(H2,27,28) |
| InChIKey | MSXYLIOTRXEQIQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,4,5-triphenylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4,5-triphenylphenyl)acetamide?
The IUPAC name of 2-(3,4,5-triphenylphenyl)acetamide (CID 178028831) is 2-(3,4,5-triphenylphenyl)acetamide.
What is the SMILES notation for 2-(3,4,5-triphenylphenyl)acetamide?
The canonical SMILES for 2-(3,4,5-triphenylphenyl)acetamide is NC(=O)Cc1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1.
What is the InChIKey of 2-(3,4,5-triphenylphenyl)acetamide?
The InChIKey is MSXYLIOTRXEQIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21NO/c27-25(28)18-19-16-23(20-10-4-1-5-11-20)26(22-14-8-3-9-15-22)24(17-19)21-12-6-2-7-13-21/h1-17H,18H2,(H2,27,28).
What are the key properties of 2-(3,4,5-triphenylphenyl)acetamide?
2-(3,4,5-triphenylphenyl)acetamide has a molecular weight of 363.46 g/mol, XLogP of 5.72, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,5-triphenylphenyl)acetamide is sourced from PubChem (CID 178028831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).