C12H10N2O3 — CID 57217041
3-phenylfuran-2,5-dicarboxamide (PubChem CID 57217041) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 3-phenylfuran-2,5-dicarboxamide.
| Compound Name | 3-phenylfuran-2,5-dicarboxamide |
|---|---|
| PubChem CID | 57217041 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-phenylfuran-2,5-dicarboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)c(C(N)=O)o1 |
| InChI | InChI=1S/C12H10N2O3/c13-11(15)9-6-8(10(17-9)12(14)16)7-4-2-1-3-5-7/h1-6H,(H2,13,15)(H2,14,16) |
| InChIKey | GDKIHZFNZYZQAL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |