C14H12N2O3 — CID 68648251
3-hydroxy-6-phenylbenzene-1,2-dicarboxamide (PubChem CID 68648251) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-hydroxy-6-phenylbenzene-1,2-dicarboxamide.
| Compound Name | 3-hydroxy-6-phenylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 68648251 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-hydroxy-6-phenylbenzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1c(O)ccc(-c2ccccc2)c1C(N)=O |
| InChI | InChI=1S/C14H12N2O3/c15-13(18)11-9(8-4-2-1-3-5-8)6-7-10(17)12(11)14(16)19/h1-7,17H,(H2,15,18)(H2,16,19) |
| InChIKey | MTXDSWSACONLST-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |