C31H25N3O — CID 174976653
2,6-bis(4-anilinophenyl)benzamide (PubChem CID 174976653) has the molecular formula C31H25N3O and a molecular weight of 455.56 g/mol. Its IUPAC name is 2,6-bis(4-anilinophenyl)benzamide.
| Compound Name | 2,6-bis(4-anilinophenyl)benzamide |
|---|---|
| PubChem CID | 174976653 |
| Molecular Formula | C31H25N3O |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2,6-bis(4-anilinophenyl)benzamide |
| SMILES | NC(=O)c1c(-c2ccc(Nc3ccccc3)cc2)cccc1-c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C31H25N3O/c32-31(35)30-28(22-14-18-26(19-15-22)33-24-8-3-1-4-9-24)12-7-13-29(30)23-16-20-27(21-17-23)34-25-10-5-2-6-11-25/h1-21,33-34H,(H2,32,35) |
| InChIKey | YXIMTYDKIVSEEQ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |