C21H19NO — CID 11301076
2,6-bis(4-methylphenyl)benzamide (PubChem CID 11301076) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is 2,6-bis(4-methylphenyl)benzamide.
| Compound Name | 2,6-bis(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 11301076 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2,6-bis(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2cccc(-c3ccc(C)cc3)c2C(N)=O)cc1 |
| InChI | InChI=1S/C21H19NO/c1-14-6-10-16(11-7-14)18-4-3-5-19(20(18)21(22)23)17-12-8-15(2)9-13-17/h3-13H,1-2H3,(H2,22,23) |
| InChIKey | DOLXQXZLVJTJAX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |