C26H20N4O4 — CID 151510869
3-[6-(2,3-dicarbamoylphenyl)naphthalen-2-yl]benzene-1,2-dicarboxamide (PubChem CID 151510869) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 3-[6-(2,3-dicarbamoylphenyl)naphthalen-2-yl]benzene-1,2-dicarboxamide.
| Compound Name | 3-[6-(2,3-dicarbamoylphenyl)naphthalen-2-yl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 151510869 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 3-[6-(2,3-dicarbamoylphenyl)naphthalen-2-yl]benzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1cccc(-c2ccc3cc(-c4cccc(C(N)=O)c4C(N)=O)ccc3c2)c1C(N)=O |
| InChI | InChI=1S/C26H20N4O4/c27-23(31)19-5-1-3-17(21(19)25(29)33)15-9-7-14-12-16(10-8-13(14)11-15)18-4-2-6-20(24(28)32)22(18)26(30)34/h1-12H,(H2,27,31)(H2,28,32)(H2,29,33)(H2,30,34) |
| InChIKey | PSLGTAWIIWFXEY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |