C16H12N6O8 — CID 87891854
3-(2,3-dicarbamoylphenyl)-4,5-dinitrobenzene-1,2-dicarboxamide (PubChem CID 87891854) has the molecular formula C16H12N6O8 and a molecular weight of 416.31 g/mol. Its IUPAC name is 3-(2,3-dicarbamoylphenyl)-4,5-dinitrobenzene-1,2-dicarboxamide.
| Compound Name | 3-(2,3-dicarbamoylphenyl)-4,5-dinitrobenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87891854 |
| Molecular Formula | C16H12N6O8 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 3-(2,3-dicarbamoylphenyl)-4,5-dinitrobenzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1cccc(-c2c(C(N)=O)c(C(N)=O)cc([N+](=O)[O-])c2[N+](=O)[O-])c1C(N)=O |
| InChI | InChI=1S/C16H12N6O8/c17-13(23)6-3-1-2-5(9(6)15(19)25)10-11(16(20)26)7(14(18)24)4-8(21(27)28)12(10)22(29)30/h1-4H,(H2,17,23)(H2,18,24)(H2,19,25)(H2,20,26) |
| InChIKey | JRCZHRLUISTEKH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 258.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|