About sodium;2-nitrobenzamide;chloride;hydrochloride
sodium;2-nitrobenzamide;chloride;hydrochloride (PubChem CID 67948148) has the molecular formula C7H7Cl2N2NaO3
and a molecular weight of 261.04 g/mol. Its IUPAC name is sodium;2-nitrobenzamide;chloride;hydrochloride.
Molecular Properties
| Compound Name | sodium;2-nitrobenzamide;chloride;hydrochloride |
| PubChem CID | 67948148 |
| Molecular Formula | C7H7Cl2N2NaO3 |
| Molecular Weight | 261.04 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | sodium;2-nitrobenzamide;chloride;hydrochloride |
| SMILES | Cl.NC(=O)c1ccccc1[N+](=O)[O-].[Cl-].[Na+] |
| InChI | InChI=1S/C7H6N2O3.2ClH.Na/c8-7(10)5-3-1-2-4-6(5)9(11)12;;;/h1-4H,(H2,8,10);2*1H;/q;;;+1/p-1 |
| InChIKey | IUWARSQRBGCNKK-UHFFFAOYSA-M |
| XLogP | -4.88 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.04 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-nitrobenzamide;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-nitrobenzamide;chloride;hydrochloride?
The IUPAC name of sodium;2-nitrobenzamide;chloride;hydrochloride (CID 67948148) is sodium;2-nitrobenzamide;chloride;hydrochloride.
What is the SMILES notation for sodium;2-nitrobenzamide;chloride;hydrochloride?
The canonical SMILES for sodium;2-nitrobenzamide;chloride;hydrochloride is Cl.NC(=O)c1ccccc1[N+](=O)[O-].[Cl-].[Na+].
What is the InChIKey of sodium;2-nitrobenzamide;chloride;hydrochloride?
The InChIKey is IUWARSQRBGCNKK-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2O3.2ClH.Na/c8-7(10)5-3-1-2-4-6(5)9(11)12;;;/h1-4H,(H2,8,10);2*1H;/q;;;+1/p-1.
What are the key properties of sodium;2-nitrobenzamide;chloride;hydrochloride?
sodium;2-nitrobenzamide;chloride;hydrochloride has a molecular weight of 261.04 g/mol, XLogP of -4.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-nitrobenzamide;chloride;hydrochloride is sourced from PubChem (CID 67948148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).