C9H9N3O4 — CID 156773626
1-N-methyl-3-nitrobenzene-1,2-dicarboxamide (PubChem CID 156773626) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is 1-N-methyl-3-nitrobenzene-1,2-dicarboxamide.
| Compound Name | 1-N-methyl-3-nitrobenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 156773626 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 1-N-methyl-3-nitrobenzene-1,2-dicarboxamide |
| SMILES | CNC(=O)c1cccc([N+](=O)[O-])c1C(N)=O |
| InChI | InChI=1S/C9H9N3O4/c1-11-9(14)5-3-2-4-6(12(15)16)7(5)8(10)13/h2-4H,1H3,(H2,10,13)(H,11,14) |
| InChIKey | UPEZJEYBEFCXIN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|