C15H21N3O8 — CID 175759057
2,4-bis(2,3-dihydroxypropyl)-1-N-methyl-5-nitrobenzene-1,3-dicarboxamide (PubChem CID 175759057) has the molecular formula C15H21N3O8 and a molecular weight of 371.35 g/mol. Its IUPAC name is 2,4-bis(2,3-dihydroxypropyl)-1-N-methyl-5-nitrobenzene-1,3-dicarboxamide.
| Compound Name | 2,4-bis(2,3-dihydroxypropyl)-1-N-methyl-5-nitrobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 175759057 |
| Molecular Formula | C15H21N3O8 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2,4-bis(2,3-dihydroxypropyl)-1-N-methyl-5-nitrobenzene-1,3-dicarboxamide |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])c(CC(O)CO)c(C(N)=O)c1CC(O)CO |
| InChI | InChI=1S/C15H21N3O8/c1-17-15(24)10-4-12(18(25)26)11(3-8(22)6-20)13(14(16)23)9(10)2-7(21)5-19/h4,7-8,19-22H,2-3,5-6H2,1H3,(H2,16,23)(H,17,24) |
| InChIKey | BCVZPOFIEUNUQX-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 196.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|