C12H13N3O4 — CID 175265315
3-N-methyl-5-nitro-2-prop-2-enylbenzene-1,3-dicarboxamide (PubChem CID 175265315) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-N-methyl-5-nitro-2-prop-2-enylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-methyl-5-nitro-2-prop-2-enylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 175265315 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-N-methyl-5-nitro-2-prop-2-enylbenzene-1,3-dicarboxamide |
| SMILES | C=CCc1c(C(N)=O)cc([N+](=O)[O-])cc1C(=O)NC |
| InChI | InChI=1S/C12H13N3O4/c1-3-4-8-9(11(13)16)5-7(15(18)19)6-10(8)12(17)14-2/h3,5-6H,1,4H2,2H3,(H2,13,16)(H,14,17) |
| InChIKey | RFZAYJXIPDNDGT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|