C10H14BrN3O3 — CID 158640072
4-(bromomethyl)-N-methyl-3-nitrobenzamide;methanamine (PubChem CID 158640072) has the molecular formula C10H14BrN3O3 and a molecular weight of 304.14 g/mol. Its IUPAC name is 4-(bromomethyl)-N-methyl-3-nitrobenzamide;methanamine.
| Compound Name | 4-(bromomethyl)-N-methyl-3-nitrobenzamide;methanamine |
|---|---|
| PubChem CID | 158640072 |
| Molecular Formula | C10H14BrN3O3 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 4-(bromomethyl)-N-methyl-3-nitrobenzamide;methanamine |
| SMILES | CN.CNC(=O)c1ccc(CBr)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9BrN2O3.CH5N/c1-11-9(13)6-2-3-7(5-10)8(4-6)12(14)15;1-2/h2-4H,5H2,1H3,(H,11,13);2H2,1H3 |
| InChIKey | IAGMQTYLHGVCTL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|