C24H34N4O8 — CID 159954706
3-amino-4-(2,2-dimethoxyethyl)-N-methylbenzamide;4-(2,2-dimethoxyethyl)-N-methyl-3-nitrobenzamide (PubChem CID 159954706) has the molecular formula C24H34N4O8 and a molecular weight of 506.56 g/mol. Its IUPAC name is 3-amino-4-(2,2-dimethoxyethyl)-N-methylbenzamide;4-(2,2-dimethoxyethyl)-N-methyl-3-nitrobenzamide.
| Compound Name | 3-amino-4-(2,2-dimethoxyethyl)-N-methylbenzamide;4-(2,2-dimethoxyethyl)-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 159954706 |
| Molecular Formula | C24H34N4O8 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 3-amino-4-(2,2-dimethoxyethyl)-N-methylbenzamide;4-(2,2-dimethoxyethyl)-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(CC(OC)OC)c(N)c1.CNC(=O)c1ccc(CC(OC)OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O5.C12H18N2O3/c1-13-12(15)9-5-4-8(7-11(18-2)19-3)10(6-9)14(16)17;1-14-12(15)9-5-4-8(10(13)6-9)7-11(16-2)17-3/h4-6,11H,7H2,1-3H3,(H,13,15);4-6,11H,7,13H2,1-3H3,(H,14,15) |
| InChIKey | OCOIWRZBQGTUTA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 164.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|