C10H13NO4 — CID 10330783
1-(2,2-dimethoxyethyl)-2-nitrobenzene (PubChem CID 10330783) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-2-nitrobenzene.
| Compound Name | 1-(2,2-dimethoxyethyl)-2-nitrobenzene |
|---|---|
| PubChem CID | 10330783 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-2-nitrobenzene |
| SMILES | COC(Cc1ccccc1[N+](=O)[O-])OC |
| InChI | InChI=1S/C10H13NO4/c1-14-10(15-2)7-8-5-3-4-6-9(8)11(12)13/h3-6,10H,7H2,1-2H3 |
| InChIKey | SFJXRPYEEMNGOJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|