C18H21NO4 — CID 10064288
1-(2,2-dimethoxyethyl)-2-(2-nitro-1-phenylethyl)benzene (PubChem CID 10064288) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-2-(2-nitro-1-phenylethyl)benzene.
| Compound Name | 1-(2,2-dimethoxyethyl)-2-(2-nitro-1-phenylethyl)benzene |
|---|---|
| PubChem CID | 10064288 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-2-(2-nitro-1-phenylethyl)benzene |
| SMILES | COC(Cc1ccccc1C(C[N+](=O)[O-])c1ccccc1)OC |
| InChI | InChI=1S/C18H21NO4/c1-22-18(23-2)12-15-10-6-7-11-16(15)17(13-19(20)21)14-8-4-3-5-9-14/h3-11,17-18H,12-13H2,1-2H3 |
| InChIKey | ADDJPMIUSSHCSE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|