C16H18O2 — CID 174663950
1-(2,2-dimethoxyethyl)-2-phenylbenzene (PubChem CID 174663950) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-2-phenylbenzene.
| Compound Name | 1-(2,2-dimethoxyethyl)-2-phenylbenzene |
|---|---|
| PubChem CID | 174663950 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-2-phenylbenzene |
| SMILES | COC(Cc1ccccc1-c1ccccc1)OC |
| InChI | InChI=1S/C16H18O2/c1-17-16(18-2)12-14-10-6-7-11-15(14)13-8-4-3-5-9-13/h3-11,16H,12H2,1-2H3 |
| InChIKey | RWNHBRCZTOXYKK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|