About ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene
ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene (PubChem CID 159880007) has the molecular formula C41H64
and a molecular weight of 556.96 g/mol. Its IUPAC name is ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene.
Molecular Properties
| Compound Name | ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene |
| PubChem CID | 159880007 |
| Molecular Formula | C41H64 |
| Molecular Weight | 556.96 g/mol |
| Exact Mass | 556.50 |
| IUPAC Name | ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene |
| SMILES | C.CC.CC.CC.CC.CC(C)C(c1ccccc1)c1ccccc1.CC(C)Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/2C16H18.4C2H6.CH4/c1-13(2)16(14-9-5-3-6-10-14)15-11-7-4-8-12-15;1-13(2)12-15-10-6-7-11-16(15)14-8-4-3-5-9-14;4*1-2;/h3-13,16H,1-2H3;3-11,13H,12H2,1-2H3;4*1-2H3;1H4 |
| InChIKey | NTKDVEGHKGFPIH-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.96 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene?
The IUPAC name of ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene (CID 159880007) is ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene.
What is the SMILES notation for ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene?
The canonical SMILES for ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene is C.CC.CC.CC.CC.CC(C)C(c1ccccc1)c1ccccc1.CC(C)Cc1ccccc1-c1ccccc1.
What is the InChIKey of ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene?
The InChIKey is NTKDVEGHKGFPIH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H18.4C2H6.CH4/c1-13(2)16(14-9-5-3-6-10-14)15-11-7-4-8-12-15;1-13(2)12-15-10-6-7-11-16(15)14-8-4-3-5-9-14;4*1-2;/h3-13,16H,1-2H3;3-11,13H,12H2,1-2H3;4*1-2H3;1H4.
What are the key properties of ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene?
ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene has a molecular weight of 556.96 g/mol, XLogP of 13.77, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;(2-methyl-1-phenylpropyl)benzene;1-(2-methylpropyl)-2-phenylbenzene is sourced from PubChem (CID 159880007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).