C22H25O3PS — CID 161022172
1-(2-methylpropyl)-2,3-diphenylbenzene;trihydroxy(sulfanylidene)-λ5-phosphane (PubChem CID 161022172) has the molecular formula C22H25O3PS and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2,3-diphenylbenzene;trihydroxy(sulfanylidene)-λ5-phosphane.
| Compound Name | 1-(2-methylpropyl)-2,3-diphenylbenzene;trihydroxy(sulfanylidene)-λ5-phosphane |
|---|---|
| PubChem CID | 161022172 |
| Molecular Formula | C22H25O3PS |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-(2-methylpropyl)-2,3-diphenylbenzene;trihydroxy(sulfanylidene)-λ5-phosphane |
| SMILES | CC(C)Cc1cccc(-c2ccccc2)c1-c1ccccc1.OP(O)(O)=S |
| InChI | InChI=1S/C22H22.H3O3PS/c1-17(2)16-20-14-9-15-21(18-10-5-3-6-11-18)22(20)19-12-7-4-8-13-19;1-4(2,3)5/h3-15,17H,16H2,1-2H3;(H3,1,2,3,5) |
| InChIKey | TYNATWZZTOAEMP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|