C20H15N — CID 151704246
2-(2,3-diphenylphenyl)acetonitrile (PubChem CID 151704246) has the molecular formula C20H15N and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-(2,3-diphenylphenyl)acetonitrile.
| Compound Name | 2-(2,3-diphenylphenyl)acetonitrile |
|---|---|
| PubChem CID | 151704246 |
| Molecular Formula | C20H15N |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(2,3-diphenylphenyl)acetonitrile |
| SMILES | N#CCc1cccc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H15N/c21-15-14-18-12-7-13-19(16-8-3-1-4-9-16)20(18)17-10-5-2-6-11-17/h1-13H,14H2 |
| InChIKey | RFFZQJZWYWEVHE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |