C28H23N — CID 140515655
2-[2,3-bis(4-methylphenyl)-4-phenylphenyl]acetonitrile (PubChem CID 140515655) has the molecular formula C28H23N and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[2,3-bis(4-methylphenyl)-4-phenylphenyl]acetonitrile.
| Compound Name | 2-[2,3-bis(4-methylphenyl)-4-phenylphenyl]acetonitrile |
|---|---|
| PubChem CID | 140515655 |
| Molecular Formula | C28H23N |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[2,3-bis(4-methylphenyl)-4-phenylphenyl]acetonitrile |
| SMILES | Cc1ccc(-c2c(CC#N)ccc(-c3ccccc3)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H23N/c1-20-8-12-23(13-9-20)27-25(18-19-29)16-17-26(22-6-4-3-5-7-22)28(27)24-14-10-21(2)11-15-24/h3-17H,18H2,1-2H3 |
| InChIKey | OYOWGSNJBAFYER-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |