C20H26O6S — CID 139670651
1-(2,2-dimethoxyethyl)-2-[2-(2,2-dimethoxyethyl)phenyl]sulfonylbenzene (PubChem CID 139670651) has the molecular formula C20H26O6S and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-2-[2-(2,2-dimethoxyethyl)phenyl]sulfonylbenzene.
| Compound Name | 1-(2,2-dimethoxyethyl)-2-[2-(2,2-dimethoxyethyl)phenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 139670651 |
| Molecular Formula | C20H26O6S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-2-[2-(2,2-dimethoxyethyl)phenyl]sulfonylbenzene |
| SMILES | COC(Cc1ccccc1S(=O)(=O)c1ccccc1CC(OC)OC)OC |
| InChI | InChI=1S/C20H26O6S/c1-23-19(24-2)13-15-9-5-7-11-17(15)27(21,22)18-12-8-6-10-16(18)14-20(25-3)26-4/h5-12,19-20H,13-14H2,1-4H3 |
| InChIKey | KMPSUNREWKQJIA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|