C23H25Br2N5O7 — CID 20668256
4-(bromomethyl)-N-[5-[[4-(bromomethyl)-3-nitrobenzoyl]amino]-6-(methylamino)-6-oxohexyl]-3-nitrobenzamide (PubChem CID 20668256) has the molecular formula C23H25Br2N5O7 and a molecular weight of 643.29 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[5-[[4-(bromomethyl)-3-nitrobenzoyl]amino]-6-(methylamino)-6-oxohexyl]-3-nitrobenzamide.
| Compound Name | 4-(bromomethyl)-N-[5-[[4-(bromomethyl)-3-nitrobenzoyl]amino]-6-(methylamino)-6-oxohexyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 20668256 |
| Molecular Formula | C23H25Br2N5O7 |
| Molecular Weight | 643.29 g/mol |
| Exact Mass | 641.01 |
| IUPAC Name | 4-(bromomethyl)-N-[5-[[4-(bromomethyl)-3-nitrobenzoyl]amino]-6-(methylamino)-6-oxohexyl]-3-nitrobenzamide |
| SMILES | CNC(=O)C(CCCCNC(=O)c1ccc(CBr)c([N+](=O)[O-])c1)NC(=O)c1ccc(CBr)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25Br2N5O7/c1-26-23(33)18(28-22(32)15-6-8-17(13-25)20(11-15)30(36)37)4-2-3-9-27-21(31)14-5-7-16(12-24)19(10-14)29(34)35/h5-8,10-11,18H,2-4,9,12-13H2,1H3,(H,26,33)(H,27,31)(H,28,32) |
| InChIKey | WOOYZHXCCAURTB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 173.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|