C20H19N4O8- — CID 7109452
(2S)-2,6-bis[(4-nitrobenzoyl)amino]hexanoate (PubChem CID 7109452) has the molecular formula C20H19N4O8- and a molecular weight of 443.39 g/mol. Its IUPAC name is (2S)-2,6-bis[(4-nitrobenzoyl)amino]hexanoate.
| Compound Name | (2S)-2,6-bis[(4-nitrobenzoyl)amino]hexanoate |
|---|---|
| PubChem CID | 7109452 |
| Molecular Formula | C20H19N4O8- |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (2S)-2,6-bis[(4-nitrobenzoyl)amino]hexanoate |
| SMILES | O=C(NCCCC[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20N4O8/c25-18(13-4-8-15(9-5-13)23(29)30)21-12-2-1-3-17(20(27)28)22-19(26)14-6-10-16(11-7-14)24(31)32/h4-11,17H,1-3,12H2,(H,21,25)(H,22,26)(H,27,28)/p-1/t17-/m0/s1 |
| InChIKey | LDAKSBDZZOKONV-KRWDZBQOSA-M |
| XLogP | 0.95 |
| TPSA | 184.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|