C19H28N4O6 — CID 11281255
(2R)-6-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-[(4-nitrobenzoyl)amino]hexanoic acid (PubChem CID 11281255) has the molecular formula C19H28N4O6 and a molecular weight of 408.46 g/mol. Its IUPAC name is (2R)-6-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-[(4-nitrobenzoyl)amino]hexanoic acid.
| Compound Name | (2R)-6-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-[(4-nitrobenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 11281255 |
| Molecular Formula | C19H28N4O6 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (2R)-6-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-[(4-nitrobenzoyl)amino]hexanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)NCCCC[C@@H](NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C19H28N4O6/c1-12(2)11-15(20)18(25)21-10-4-3-5-16(19(26)27)22-17(24)13-6-8-14(9-7-13)23(28)29/h6-9,12,15-16H,3-5,10-11,20H2,1-2H3,(H,21,25)(H,22,24)(H,26,27)/t15-,16+/m0/s1 |
| InChIKey | WQRXROPUBYLEDV-JKSUJKDBSA-N |
| XLogP | 1.44 |
| TPSA | 164.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|