C20H27N3O8 — CID 175124076
2-(2,2-dimethylpropoxycarbonylamino)-6-[[2-(4-nitrophenyl)-2-oxoacetyl]amino]hexanoic acid (PubChem CID 175124076) has the molecular formula C20H27N3O8 and a molecular weight of 437.45 g/mol. Its IUPAC name is 2-(2,2-dimethylpropoxycarbonylamino)-6-[[2-(4-nitrophenyl)-2-oxoacetyl]amino]hexanoic acid.
| Compound Name | 2-(2,2-dimethylpropoxycarbonylamino)-6-[[2-(4-nitrophenyl)-2-oxoacetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175124076 |
| Molecular Formula | C20H27N3O8 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-(2,2-dimethylpropoxycarbonylamino)-6-[[2-(4-nitrophenyl)-2-oxoacetyl]amino]hexanoic acid |
| SMILES | CC(C)(C)COC(=O)NC(CCCCNC(=O)C(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C20H27N3O8/c1-20(2,3)12-31-19(28)22-15(18(26)27)6-4-5-11-21-17(25)16(24)13-7-9-14(10-8-13)23(29)30/h7-10,15H,4-6,11-12H2,1-3H3,(H,21,25)(H,22,28)(H,26,27) |
| InChIKey | NQDGHENEELEOAI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|