C29H29N3O7 — CID 59015249
methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-nitrobenzoyl)amino]hexanoate (PubChem CID 59015249) has the molecular formula C29H29N3O7 and a molecular weight of 531.57 g/mol. Its IUPAC name is methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-nitrobenzoyl)amino]hexanoate.
| Compound Name | methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-nitrobenzoyl)amino]hexanoate |
|---|---|
| PubChem CID | 59015249 |
| Molecular Formula | C29H29N3O7 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-nitrobenzoyl)amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)c1ccc([N+](=O)[O-])cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H29N3O7/c1-38-28(34)26(12-6-7-17-30-27(33)19-13-15-20(16-14-19)32(36)37)31-29(35)39-18-25-23-10-4-2-8-21(23)22-9-3-5-11-24(22)25/h2-5,8-11,13-16,25-26H,6-7,12,17-18H2,1H3,(H,30,33)(H,31,35)/t26-/m0/s1 |
| InChIKey | CZPGJWQLJALJHS-SANMLTNESA-N |
| XLogP | 4.58 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|