C41H45BN2O7 — CID 11239375
benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]hexanoate (PubChem CID 11239375) has the molecular formula C41H45BN2O7 and a molecular weight of 688.63 g/mol. Its IUPAC name is benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]hexanoate.
| Compound Name | benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 11239375 |
| Molecular Formula | C41H45BN2O7 |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 688.33 |
| IUPAC Name | benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]hexanoate |
| SMILES | CC1(C)OB(c2ccc(C(=O)NCCCC[C@H](NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)OCc3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C41H45BN2O7/c1-40(2)41(3,4)51-42(50-40)30-23-21-29(22-24-30)37(45)43-25-13-12-20-36(38(46)48-26-28-14-6-5-7-15-28)44-39(47)49-27-35-33-18-10-8-16-31(33)32-17-9-11-19-34(32)35/h5-11,14-19,21-24,35-36H,12-13,20,25-27H2,1-4H3,(H,43,45)(H,44,47)/t36-/m0/s1 |
| InChIKey | LSCQXTYRNKCODP-BHVANESWSA-N |
| XLogP | 6.54 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|