C30H30N2O6 — CID 88902842
methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-formylbenzoyl)amino]hexanoate (PubChem CID 88902842) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-formylbenzoyl)amino]hexanoate.
| Compound Name | methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-formylbenzoyl)amino]hexanoate |
|---|---|
| PubChem CID | 88902842 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(4-formylbenzoyl)amino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)c1ccc(C=O)cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H30N2O6/c1-37-29(35)27(12-6-7-17-31-28(34)21-15-13-20(18-33)14-16-21)32-30(36)38-19-26-24-10-4-2-8-22(24)23-9-3-5-11-25(23)26/h2-5,8-11,13-16,18,26-27H,6-7,12,17,19H2,1H3,(H,31,34)(H,32,36) |
| InChIKey | WWSHVCFUGSBPDW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|