C26H26N2O5S — CID 134715297
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(thiophene-3-carbonylamino)hexanoic acid (PubChem CID 134715297) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(thiophene-3-carbonylamino)hexanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(thiophene-3-carbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 134715297 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(thiophene-3-carbonylamino)hexanoic acid |
| SMILES | O=C(N[C@@H](CCCCNC(=O)c1ccsc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H26N2O5S/c29-24(17-12-14-34-16-17)27-13-6-5-11-23(25(30)31)28-26(32)33-15-22-20-9-3-1-7-18(20)19-8-2-4-10-21(19)22/h1-4,7-10,12,14,16,22-23H,5-6,11,13,15H2,(H,27,29)(H,28,32)(H,30,31)/t23-/m0/s1 |
| InChIKey | YMZTZJGGGBZILV-QHCPKHFHSA-N |
| XLogP | 4.64 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|