C31H30N6O5 — CID 74223024
2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzoyl]amino]hexanoic acid (PubChem CID 74223024) has the molecular formula C31H30N6O5 and a molecular weight of 566.62 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzoyl]amino]hexanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 74223024 |
| Molecular Formula | C31H30N6O5 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzoyl]amino]hexanoic acid |
| SMILES | Cc1nnc(-c2ccc(C(=O)NCCCCC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)cc2)nn1 |
| InChI | InChI=1S/C31H30N6O5/c1-19-34-36-28(37-35-19)20-13-15-21(16-14-20)29(38)32-17-7-6-12-27(30(39)40)33-31(41)42-18-26-24-10-4-2-8-22(24)23-9-3-5-11-25(23)26/h2-5,8-11,13-16,26-27H,6-7,12,17-18H2,1H3,(H,32,38)(H,33,41)(H,39,40) |
| InChIKey | ITTVSARVAAUAKA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 156.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|