C32H35N5O5 — CID 178156738
tert-butyl (2S)-6-[(4-azidobenzoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 178156738) has the molecular formula C32H35N5O5 and a molecular weight of 569.66 g/mol. Its IUPAC name is tert-butyl (2S)-6-[(4-azidobenzoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | tert-butyl (2S)-6-[(4-azidobenzoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 178156738 |
| Molecular Formula | C32H35N5O5 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | tert-butyl (2S)-6-[(4-azidobenzoyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCNC(=O)c1ccc(N=[N+]=[N-])cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H35N5O5/c1-32(2,3)42-30(39)28(14-8-9-19-34-29(38)21-15-17-22(18-16-21)36-37-33)35-31(40)41-20-27-25-12-6-4-10-23(25)24-11-5-7-13-26(24)27/h4-7,10-13,15-18,27-28H,8-9,14,19-20H2,1-3H3,(H,34,38)(H,35,40)/t28-/m0/s1 |
| InChIKey | GQMSNQJUGCCGCM-NDEPHWFRSA-N |
| XLogP | 6.78 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|