C22H26N4O7 — CID 11294073
(2R)-6-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-[(4-nitrobenzoyl)amino]hexanoic acid (PubChem CID 11294073) has the molecular formula C22H26N4O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is (2R)-6-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-[(4-nitrobenzoyl)amino]hexanoic acid.
| Compound Name | (2R)-6-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-[(4-nitrobenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 11294073 |
| Molecular Formula | C22H26N4O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (2R)-6-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-[(4-nitrobenzoyl)amino]hexanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCC[C@@H](NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C22H26N4O7/c23-18(13-14-4-10-17(27)11-5-14)21(29)24-12-2-1-3-19(22(30)31)25-20(28)15-6-8-16(9-7-15)26(32)33/h4-11,18-19,27H,1-3,12-13,23H2,(H,24,29)(H,25,28)(H,30,31)/t18-,19+/m0/s1 |
| InChIKey | LASDQLSHBYSTOI-RBUKOAKNSA-N |
| XLogP | 1.34 |
| TPSA | 184.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|