C13H16N2O7S — CID 108755125
4-ethylsulfonyl-2-[(4-nitrobenzoyl)amino]butanoic acid (PubChem CID 108755125) has the molecular formula C13H16N2O7S and a molecular weight of 344.35 g/mol. Its IUPAC name is 4-ethylsulfonyl-2-[(4-nitrobenzoyl)amino]butanoic acid.
| Compound Name | 4-ethylsulfonyl-2-[(4-nitrobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 108755125 |
| Molecular Formula | C13H16N2O7S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-ethylsulfonyl-2-[(4-nitrobenzoyl)amino]butanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C13H16N2O7S/c1-2-23(21,22)8-7-11(13(17)18)14-12(16)9-3-5-10(6-4-9)15(19)20/h3-6,11H,2,7-8H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | UYLFFFYGTGWKCX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|