C14H17N3O9S — CID 108731649
4-ethylsulfonyl-2-[(2-methyl-3,5-dinitrobenzoyl)amino]butanoic acid (PubChem CID 108731649) has the molecular formula C14H17N3O9S and a molecular weight of 403.37 g/mol. Its IUPAC name is 4-ethylsulfonyl-2-[(2-methyl-3,5-dinitrobenzoyl)amino]butanoic acid.
| Compound Name | 4-ethylsulfonyl-2-[(2-methyl-3,5-dinitrobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 108731649 |
| Molecular Formula | C14H17N3O9S |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 4-ethylsulfonyl-2-[(2-methyl-3,5-dinitrobenzoyl)amino]butanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C)C(=O)O |
| InChI | InChI=1S/C14H17N3O9S/c1-3-27(25,26)5-4-11(14(19)20)15-13(18)10-6-9(16(21)22)7-12(8(10)2)17(23)24/h6-7,11H,3-5H2,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | MWZONZCTLOJXQQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 186.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|