C11H15N3O5Si — CID 91697364
2-methyl-3,5-dinitro-N-trimethylsilylbenzamide (PubChem CID 91697364) has the molecular formula C11H15N3O5Si and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-methyl-3,5-dinitro-N-trimethylsilylbenzamide.
| Compound Name | 2-methyl-3,5-dinitro-N-trimethylsilylbenzamide |
|---|---|
| PubChem CID | 91697364 |
| Molecular Formula | C11H15N3O5Si |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-methyl-3,5-dinitro-N-trimethylsilylbenzamide |
| SMILES | Cc1c(C(=O)N[Si](C)(C)C)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O5Si/c1-7-9(11(15)12-20(2,3)4)5-8(13(16)17)6-10(7)14(18)19/h5-6H,1-4H3,(H,12,15) |
| InChIKey | MNADNQAGPRPGMI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|