C17H23N5O5 — CID 51059996
N-(N'-cyclooctylcarbamimidoyl)-2-methyl-3,5-dinitrobenzamide (PubChem CID 51059996) has the molecular formula C17H23N5O5 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(N'-cyclooctylcarbamimidoyl)-2-methyl-3,5-dinitrobenzamide.
| Compound Name | N-(N'-cyclooctylcarbamimidoyl)-2-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 51059996 |
| Molecular Formula | C17H23N5O5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(N'-cyclooctylcarbamimidoyl)-2-methyl-3,5-dinitrobenzamide |
| SMILES | Cc1c(C(=O)N/C(N)=N/C2CCCCCCC2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N5O5/c1-11-14(9-13(21(24)25)10-15(11)22(26)27)16(23)20-17(18)19-12-7-5-3-2-4-6-8-12/h9-10,12H,2-8H2,1H3,(H3,18,19,20,23) |
| InChIKey | RRXUMCHASCHXSR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 153.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|