C14H19N3O6 — CID 51056886
N-cyclohexyl-2-methyl-3,5-dinitrobenzamide;hydrate (PubChem CID 51056886) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is N-cyclohexyl-2-methyl-3,5-dinitrobenzamide;hydrate.
| Compound Name | N-cyclohexyl-2-methyl-3,5-dinitrobenzamide;hydrate |
|---|---|
| PubChem CID | 51056886 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-cyclohexyl-2-methyl-3,5-dinitrobenzamide;hydrate |
| SMILES | Cc1c(C(=O)NC2CCCCC2)cc([N+](=O)[O-])cc1[N+](=O)[O-].O |
| InChI | InChI=1S/C14H17N3O5.H2O/c1-9-12(14(18)15-10-5-3-2-4-6-10)7-11(16(19)20)8-13(9)17(21)22;/h7-8,10H,2-6H2,1H3,(H,15,18);1H2 |
| InChIKey | NFMZZJZECMIQGC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|