C16H21NO8S — CID 108755110
2-[(4-ethoxycarbonyloxybenzoyl)amino]-4-ethylsulfonylbutanoic acid (PubChem CID 108755110) has the molecular formula C16H21NO8S and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-[(4-ethoxycarbonyloxybenzoyl)amino]-4-ethylsulfonylbutanoic acid.
| Compound Name | 2-[(4-ethoxycarbonyloxybenzoyl)amino]-4-ethylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 108755110 |
| Molecular Formula | C16H21NO8S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-[(4-ethoxycarbonyloxybenzoyl)amino]-4-ethylsulfonylbutanoic acid |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NC(CCS(=O)(=O)CC)C(=O)O)cc1 |
| InChI | InChI=1S/C16H21NO8S/c1-3-24-16(21)25-12-7-5-11(6-8-12)14(18)17-13(15(19)20)9-10-26(22,23)4-2/h5-8,13H,3-4,9-10H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | OWQBOBLDKZHTIZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|