C17H20N4O9S — CID 46834486
(2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[(4-nitrobenzoyl)amino]-5-oxopentanoic acid (PubChem CID 46834486) has the molecular formula C17H20N4O9S and a molecular weight of 456.43 g/mol. Its IUPAC name is (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[(4-nitrobenzoyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[(4-nitrobenzoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 46834486 |
| Molecular Formula | C17H20N4O9S |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[(4-nitrobenzoyl)amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CNC(=O)[C@H](CS)NC(=O)CC[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C17H20N4O9S/c22-13(19-12(8-31)16(26)18-7-14(23)24)6-5-11(17(27)28)20-15(25)9-1-3-10(4-2-9)21(29)30/h1-4,11-12,31H,5-8H2,(H,18,26)(H,19,22)(H,20,25)(H,23,24)(H,27,28)/t11-,12-/m0/s1 |
| InChIKey | XTIZSJBFWSHNGL-RYUDHWBXSA-N |
| XLogP | -0.83 |
| TPSA | 205.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|