C22H26N3O6PS2 — CID 139647759
(2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(diphenylphosphinothioylamino)-5-oxopentanoic acid (PubChem CID 139647759) has the molecular formula C22H26N3O6PS2 and a molecular weight of 523.57 g/mol. Its IUPAC name is (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(diphenylphosphinothioylamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(diphenylphosphinothioylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139647759 |
| Molecular Formula | C22H26N3O6PS2 |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(diphenylphosphinothioylamino)-5-oxopentanoic acid |
| SMILES | O=C(O)CNC(=O)[C@H](CS)NC(=O)CC[C@H](NP(=S)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H26N3O6PS2/c26-19(24-18(14-33)21(29)23-13-20(27)28)12-11-17(22(30)31)25-32(34,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-18,33H,11-14H2,(H,23,29)(H,24,26)(H,25,34)(H,27,28)(H,30,31)/t17-,18-/m0/s1 |
| InChIKey | NCBAHFPZKIUMDJ-ROUUACIJSA-N |
| XLogP | 0.47 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|