C10H16AsN3O7S — CID 141143008
(2S)-2-(arsorosoamino)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 141143008) has the molecular formula C10H16AsN3O7S and a molecular weight of 397.24 g/mol. Its IUPAC name is (2S)-2-(arsorosoamino)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-(arsorosoamino)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 141143008 |
| Molecular Formula | C10H16AsN3O7S |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | (2S)-2-(arsorosoamino)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | O=[As]N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16AsN3O7S/c15-7(2-1-5(10(19)20)14-11-21)13-6(4-22)9(18)12-3-8(16)17/h5-6,22H,1-4H2,(H,12,18)(H,13,15)(H,14,21)(H,16,17)(H,19,20)/t5-,6-/m0/s1 |
| InChIKey | GGNWJYXSZIECIP-WDSKDSINSA-N |
| XLogP | -2.61 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|