C13H21ClN4O7S — CID 140688947
(2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(2-chloroethylcarbamoylamino)-5-oxopentanoic acid (PubChem CID 140688947) has the molecular formula C13H21ClN4O7S and a molecular weight of 412.85 g/mol. Its IUPAC name is (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(2-chloroethylcarbamoylamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(2-chloroethylcarbamoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 140688947 |
| Molecular Formula | C13H21ClN4O7S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(2-chloroethylcarbamoylamino)-5-oxopentanoic acid |
| SMILES | O=C(O)CNC(=O)[C@H](CS)NC(=O)CC[C@H](NC(=O)NCCCl)C(=O)O |
| InChI | InChI=1S/C13H21ClN4O7S/c14-3-4-15-13(25)18-7(12(23)24)1-2-9(19)17-8(6-26)11(22)16-5-10(20)21/h7-8,26H,1-6H2,(H,16,22)(H,17,19)(H,20,21)(H,23,24)(H2,15,18,25)/t7-,8-/m0/s1 |
| InChIKey | QUUIHVCMEKQOTF-YUMQZZPRSA-N |
| XLogP | -1.63 |
| TPSA | 173.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|