C17H22N4O8S — CID 87252111
(2S)-2-[benzyl(nitro)amino]-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 87252111) has the molecular formula C17H22N4O8S and a molecular weight of 442.45 g/mol. Its IUPAC name is (2S)-2-[benzyl(nitro)amino]-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-[benzyl(nitro)amino]-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87252111 |
| Molecular Formula | C17H22N4O8S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (2S)-2-[benzyl(nitro)amino]-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CNC(=O)[C@H](CS)NC(=O)CC[C@@H](C(=O)O)N(Cc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N4O8S/c22-14(19-12(10-30)16(25)18-8-15(23)24)7-6-13(17(26)27)20(21(28)29)9-11-4-2-1-3-5-11/h1-5,12-13,30H,6-10H2,(H,18,25)(H,19,22)(H,23,24)(H,26,27)/t12-,13-/m0/s1 |
| InChIKey | ZLDQUFXUQWDKLP-STQMWFEESA-N |
| XLogP | -0.47 |
| TPSA | 179.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|