C24H32N4O11 — CID 11678417
(2S)-2-[[(4S)-4-carboxy-4-[8-[(4-nitrobenzoyl)amino]octanoylamino]butanoyl]amino]butanedioic acid (PubChem CID 11678417) has the molecular formula C24H32N4O11 and a molecular weight of 552.54 g/mol. Its IUPAC name is (2S)-2-[[(4S)-4-carboxy-4-[8-[(4-nitrobenzoyl)amino]octanoylamino]butanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(4S)-4-carboxy-4-[8-[(4-nitrobenzoyl)amino]octanoylamino]butanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 11678417 |
| Molecular Formula | C24H32N4O11 |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | (2S)-2-[[(4S)-4-carboxy-4-[8-[(4-nitrobenzoyl)amino]octanoylamino]butanoyl]amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)CC[C@H](NC(=O)CCCCCCCNC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H32N4O11/c29-19(26-17(23(34)35)11-12-20(30)27-18(24(36)37)14-21(31)32)6-4-2-1-3-5-13-25-22(33)15-7-9-16(10-8-15)28(38)39/h7-10,17-18H,1-6,11-14H2,(H,25,33)(H,26,29)(H,27,30)(H,31,32)(H,34,35)(H,36,37)/t17-,18-/m0/s1 |
| InChIKey | YEZOYBNKRYWGFK-ROUUACIJSA-N |
| XLogP | 1.06 |
| TPSA | 242.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|