C14H18N4O6 — CID 46890621
N-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]-4-nitrobenzamide (PubChem CID 46890621) has the molecular formula C14H18N4O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is N-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]-4-nitrobenzamide.
| Compound Name | N-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 46890621 |
| Molecular Formula | C14H18N4O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]-4-nitrobenzamide |
| SMILES | O=C(CCCCCNC(=O)NC(=O)c1ccc([N+](=O)[O-])cc1)NO |
| InChI | InChI=1S/C14H18N4O6/c19-12(17-22)4-2-1-3-9-15-14(21)16-13(20)10-5-7-11(8-6-10)18(23)24/h5-8,22H,1-4,9H2,(H,17,19)(H2,15,16,20,21) |
| InChIKey | KVLGBDQRHFSXJT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|