C22H21F4N3O5 — CID 74374698
6-[[3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(4-nitrophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide (PubChem CID 74374698) has the molecular formula C22H21F4N3O5 and a molecular weight of 483.42 g/mol. Its IUPAC name is 6-[[3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(4-nitrophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide.
| Compound Name | 6-[[3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(4-nitrophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 74374698 |
| Molecular Formula | C22H21F4N3O5 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 6-[[3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(4-nitrophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCNC(=O)C(=Cc1ccc(F)c(C(F)(F)F)c1)c1ccc([N+](=O)[O-])cc1)NO |
| InChI | InChI=1S/C22H21F4N3O5/c23-19-10-5-14(13-18(19)22(24,25)26)12-17(15-6-8-16(9-7-15)29(33)34)21(31)27-11-3-1-2-4-20(30)28-32/h5-10,12-13,32H,1-4,11H2,(H,27,31)(H,28,30) |
| InChIKey | OLRBDPBXEWFUDG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|